BIOPEP-UWM: Report
| ID | 11336 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 4 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 476.4819 | Monoisotopic mass | 476.2013 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amjad A., Wang R., Zhao L., Du L., Xie J. | |
| Title | |
| A novel high-throughput screening strategy for identification of highly active xanthine oxidase inhibitory peptides. J. Mol. Struct., 1353, 144666, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C21H28N6O7/c1-10(28)18(23)20(32)25-9-17(30)26-14(7-16(22)29)19(31)27-15(21(33)34)6-11-8-24-13-5-3-2-4-12(11)13/h2-5,8,10,14-15,18,24,28H,6-7,9,23H2,1H3,(H2,22,29)(H,25,32)(H,26,30)(H,27,31)(H,33,34)/t10-,14+,15+,18+/m1/s1 InChIKey=OLXJNUVVURZOIP-RXUCDUSASA-N |
| Database reference: |