BIOPEP-UWM: Report
| ID | 11337 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 4 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 511.5721 | Monoisotopic mass | 511.2536 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amjad A., Wang R., Zhao L., Du L., Xie J. | |
| Title | |
| A novel high-throughput screening strategy for identification of highly active xanthine oxidase inhibitory peptides. J. Mol. Struct., 1353, 144666, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C25H33N7O5/c1-3-14(2)22(32-23(34)19(30-21(33)10-26)9-16-12-27-13-29-16)24(35)31-20(25(36)37)8-15-11-28-18-7-5-4-6-17(15)18/h4-7,11-14,19-20,22,28H,3,8-10,26H2,1-2H3,(H,27,29)(H,30,33)(H,31,35)(H,32,34)(H,36,37)/t14-,19-,20-,22-/m0/s1 InChIKey=IHGCJCBKCXWETI-YXXMBDFVSA-N |
| Database reference: |