BIOPEP-UWM: Report
| ID | 11339 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 4 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 534.5179 | Monoisotopic mass | 534.2067 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amjad A., Wang R., Zhao L., Du L., Xie J. | |
| Title | |
| A novel high-throughput screening strategy for identification of highly active xanthine oxidase inhibitory peptides. J. Mol. Struct., 1353, 144666, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C23H30N6O9/c1-10(30)19(25)22(36)28-14(7-17(24)31)20(34)27-15(8-18(32)33)21(35)29-16(23(37)38)6-11-9-26-13-5-3-2-4-12(11)13/h2-5,9-10,14-16,19,26,30H,6-8,25H2,1H3,(H2,24,31)(H,27,34)(H,28,36)(H,29,35)(H,32,33)(H,37,38)/t10-,14+,15+,16+,19+/m1/s1 InChIKey=ZVHHHLAACQKDDZ-HONSXENPSA-N |
| Database reference: |