BIOPEP-UWM: Report
| ID | 11344 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 10 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 1097.2653 | Monoisotopic mass | 1096.6334 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C47H84N16O14/c1-9-23(4)34(61-37(68)25(6)55-36(67)24(5)48)42(73)56-26(7)38(69)62-35(27(8)64)43(74)58-29(14-11-19-54-47(51)52)39(70)59-30(16-17-33(65)66)44(75)63-20-12-15-32(63)41(72)57-28(13-10-18-53-46(49)50)40(71)60-31(45(76)77)21-22(2)3/h22-32,34-35,64H,9-21,48H2,1-8H3,(H,55,67)(H,56,73)(H,57,72)(H,58,74)(H,59,70)(H,60,71)(H,61,68)(H,62,69)(H,65,66)(H,76,77)(H4,49,50,53)(H4,51,52,54)/t23-,24-,25-,26-,27+,28-,29-,30-,31-,32-,34-,35-/m0/s1 InChIKey=WNOVOQRLOPSXER-HMHWKOGUSA-N |
| Database reference: |