BIOPEP-UWM: Report
| ID | 11352 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 3 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 411.4549 | Monoisotopic mass | 411.2224 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C17H29N7O5/c18-6-2-1-3-13(17(28)29)24-16(27)12(4-5-14(20)25)23-15(26)11(19)7-10-8-21-9-22-10/h8-9,11-13H,1-7,18-19H2,(H2,20,25)(H,21,22)(H,23,26)(H,24,27)(H,28,29)/t11-,12-,13-/m0/s1 InChIKey=NWGXCPUKPVISSJ-AVGNSLFASA-N |
| Database reference: |
| ChEBI: ID 164411 EPA DSSTox: ID DTXSID001371254 Metabolomics Workbench: ID 82367 PubChem: CID 145455821 UniChem: ID 176704374 Wikidata: ID Q106023688 |