BIOPEP-UWM: Report
| ID | 11357 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 525.6609 | Monoisotopic mass | 525.2612 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C24H39N5O6S/c1-15(30)20(23(33)28-19(24(34)35)14-16-8-4-3-5-9-16)29-22(32)18(10-6-7-12-25)27-21(31)17(26)11-13-36-2/h3-5,8-9,15,17-20,30H,6-7,10-14,25-26H2,1-2H3,(H,27,31)(H,28,33)(H,29,32)(H,34,35)/t15-,17+,18+,19+,20+/m1/s1 InChIKey=JDCLPWNPIXECBD-HTDHLNIYSA-N |
| Database reference: |