BIOPEP-UWM: Report
| ID | 11358 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 6 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 532.5862 | Monoisotopic mass | 532.2847 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C22H40N6O9/c1-7-9(2)15(27-17(31)10(3)23)20(34)25-11(4)18(32)24-12(5)19(33)28-16(13(6)30)21(35)26-14(8-29)22(36)37/h9-16,29-30H,7-8,23H2,1-6H3,(H,24,32)(H,25,34)(H,26,35)(H,27,31)(H,28,33)(H,36,37)/t9-,10-,11-,12-,13+,14-,15-,16-/m0/s1 InChIKey=XSFFCLOZYNMXQY-ODXXHAAOSA-N |
| Database reference: |