BIOPEP-UWM: Report
| ID | 11360 |
| Name | Hypotensive peptide |
| sequence |
| Function: | |||
| Lowering blood pressure in rats | |||
| Number of residues | 3 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 335.3971 | Monoisotopic mass | 335.1839 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K., Chen J.-R. | |
| Title | |
| Identification of antihypertensive peptides from peptic digest of two microalgae, Chlorella vulgaris and Spirulina platensis. Marine Biotechnol., 3, 305–309, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C17H25N3O4/c1-10(2)14(18)16(22)19-11(3)15(21)20-13(17(23)24)9-12-7-5-4-6-8-12/h4-8,10-11,13-14H,9,18H2,1-3H3,(H,19,22)(H,20,21)(H,23,24)/t11-,13-,14-/m0/s1 InChIKey=JFAWZADYPRMRCO-UBHSHLNASA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 8126), the DFBP database |
| Database reference: |
| AHTPDB: ID 1038; 1870 BIOPEP-UWM database of bioactive peptides: ID 8126 BRENDA: Ligand Val-Ala-Phe-OH ChEBI: ID 166067 DFBP: ID DFBPACEI1518; DFBPANHY0450; DFBPMUFU0419 EROP-Moscow: ID E07058 Metabolomics Workbench: ID 86669 PubChem: CID 25183088 SATPdb: ID satpdb14951 SureChEMBL: ID 30051124 UniChem: ID 33173387 Wikidata: ID Q106029078 |