BIOPEP-UWM: Report
| ID | 11369 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 8 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 863.8692 | Monoisotopic mass | 863.3761 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C36H53N11O14/c1-17(37)30(54)44-22(10-13-29(52)53)33(57)42-18(2)31(55)46-23(15-27(40)50)35(59)45-20(8-11-25(38)48)32(56)41-16-28(51)43-21(9-12-26(39)49)34(58)47-24(36(60)61)14-19-6-4-3-5-7-19/h3-7,17-18,20-24H,8-16,37H2,1-2H3,(H2,38,48)(H2,39,49)(H2,40,50)(H,41,56)(H,42,57)(H,43,51)(H,44,54)(H,45,59)(H,46,55)(H,47,58)(H,52,53)(H,60,61)/t17-,18-,20-,21-,22-,23-,24-/m0/s1 InChIKey=KKTJTNAISIXDOW-HRALPVODSA-N |
| Database reference: |