BIOPEP-UWM: Report
| ID | 11372 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 797.8508 | Monoisotopic mass | 797.3906 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C34H55N9O13/c1-3-17(2)27(42-31(52)20(9-12-25(36)46)38-28(49)18-6-4-14-37-18)33(54)43-15-5-7-23(43)32(53)40-21(10-13-26(47)48)29(50)39-19(8-11-24(35)45)30(51)41-22(16-44)34(55)56/h17-23,27,37,44H,3-16H2,1-2H3,(H2,35,45)(H2,36,46)(H,38,49)(H,39,50)(H,40,53)(H,41,51)(H,42,52)(H,47,48)(H,55,56)/t17-,18-,19-,20-,21-,22-,23-,27-/m0/s1 InChIKey=YAHSWNUGSNNLBZ-DJCJEFMLSA-N |
| Database reference: |