BIOPEP-UWM: Report
| ID | 11375 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 4 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 374.3885 | Monoisotopic mass | 374.1795 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C15H26N4O7/c1-7(17-13(23)9-4-3-5-16-9)12(22)19-11(8(2)21)14(24)18-10(6-20)15(25)26/h7-11,16,20-21H,3-6H2,1-2H3,(H,17,23)(H,18,24)(H,19,22)(H,25,26)/t7-,8+,9-,10-,11-/m0/s1 InChIKey=UYFCUDIZVYDOOG-SSRBZLIGSA-N |
| Database reference: |