BIOPEP-UWM: Report
| ID | 11383 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 587.6233 | Monoisotopic mass | 587.2695 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C27H37N7O8/c1-14(35)23(26(40)33-20(27(41)42)11-15-12-30-17-6-3-2-5-16(15)17)34-25(39)19(8-9-21(28)36)32-22(37)13-31-24(38)18-7-4-10-29-18/h2-3,5-6,12,14,18-20,23,29-30,35H,4,7-11,13H2,1H3,(H2,28,36)(H,31,38)(H,32,37)(H,33,40)(H,34,39)(H,41,42)/t14-,18+,19+,20+,23+/m1/s1 InChIKey=SOCMHIWDDODMCK-XUQLPURUSA-N |
| Database reference: |