BIOPEP-UWM: Report
| ID | 11392 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 3 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 440.4944 | Monoisotopic mass | 440.2166 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amjad A., Wang R., Zhao L., Du L., Xie J. | |
| Title | |
| A novel high-throughput screening strategy for identification of highly active xanthine oxidase inhibitory peptides. J. Mol. Struct., 1353, 144666, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C22H28N6O4/c1-12(2)19(23)21(30)27-17(8-14-10-24-11-26-14)20(29)28-18(22(31)32)7-13-9-25-16-6-4-3-5-15(13)16/h3-6,9-12,17-19,25H,7-8,23H2,1-2H3,(H,24,26)(H,27,30)(H,28,29)(H,31,32)/t17-,18-,19-/m0/s1 InChIKey=MJXNDRCLGDSBBE-FHWLQOOXSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9351) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9351 ChEBI: ID 166230 DFBP: ID DFBPACEI1820; DFBPANHY0966; DFBPMUFU0541 Metabolomics Workbench: ID 86833 PubChem: CID 145458942 SureChEMBL: ID 29750395 UniChem: ID 176707427 Wikidata: ID Q106025052 |