BIOPEP-UWM: Report
| ID | 11394 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 3 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 360.4066 | Monoisotopic mass | 360.1792 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amjad A., Wang R., Zhao L., Du L., Xie J. | |
| Title | |
| A novel high-throughput screening strategy for identification of highly active xanthine oxidase inhibitory peptides. J. Mol. Struct., 1353, 144666, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)NCC(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C18H24N4O4/c1-10(2)16(19)17(24)21-9-15(23)22-14(18(25)26)7-11-8-20-13-6-4-3-5-12(11)13/h3-6,8,10,14,16,20H,7,9,19H2,1-2H3,(H,21,24)(H,22,23)(H,25,26)/t14-,16-/m0/s1 InChIKey=JVYIGCARISMLMV-HOCLYGCPSA-N |
| Database reference: |
| ChEBI: ID 166210 Metabolomics Workbench: ID 86813 PubChem: CID 145458928 SureChEMBL: ID 30053213 UniChem: ID 176707413 Wikidata: ID Q106025023 |