BIOPEP-UWM: Report
| ID | 11395 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 4 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 447.4837 | Monoisotopic mass | 447.2111 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amjad A., Wang R., Zhao L., Du L., Xie J. | |
| Title | |
| A novel high-throughput screening strategy for identification of highly active xanthine oxidase inhibitory peptides. J. Mol. Struct., 1353, 144666, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C21H29N5O6/c1-11(2)18(22)20(30)26-16(10-27)19(29)24-9-17(28)25-15(21(31)32)7-12-8-23-14-6-4-3-5-13(12)14/h3-6,8,11,15-16,18,23,27H,7,9-10,22H2,1-2H3,(H,24,29)(H,25,28)(H,26,30)(H,31,32)/t15-,16-,18-/m0/s1 InChIKey=PKCYXQNPILZXFJ-BQFCYCMXSA-N |
| Database reference: |