BIOPEP-UWM: Report
| ID | 11397 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 3 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 402.4861 | Monoisotopic mass | 402.2260 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amjad A., Wang R., Zhao L., Du L., Xie J. | |
| Title | |
| A novel high-throughput screening strategy for identification of highly active xanthine oxidase inhibitory peptides. J. Mol. Struct., 1353, 144666, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C21H30N4O4/c1-11(2)17(22)19(26)25-18(12(3)4)20(27)24-16(21(28)29)9-13-10-23-15-8-6-5-7-14(13)15/h5-8,10-12,16-18,23H,9,22H2,1-4H3,(H,24,27)(H,25,26)(H,28,29)/t16-,17-,18-/m0/s1 InChIKey=WHNSHJJNWNSTSU-BZSNNMDCSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the DFBP database |
| Database reference: |
| BRENDA: Ligand L-Val-L-Val-L-Trp ChEBI: ID 166449 DFBP: ID DFBPACEI1825 Metabolomics Workbench: ID 87053 PubChem: CID 54431100 SureChEMBL: ID 30051553 UniChem: ID 25594001 Wikidata: ID Q106025374 |