BIOPEP-UWM: Report
| ID | 11402 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 696.6614 | Monoisotopic mass | 696.2705 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Manzanilla-Valdez M. L., Montaño S., Martinez-Villaluenga C., Zúñiga F., Boesch C., Hernandez-Alvarez A. J. | |
| Title | |
| Antioxidant, hypotensive, and antidiabetic breakthroughs: bromelain hydrolysis unlocks quinoa’s peptide potential - in silico and in vitro approach. J. Agric. Food Chem., 73, 22877−22894, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C28H40N8O13/c29-15(10-13-3-5-14(37)6-4-13)23(44)35-18(11-21(40)41)26(47)36-19(12-22(42)43)25(46)33-16(7-8-20(38)39)24(45)34-17(27(48)49)2-1-9-32-28(30)31/h3-6,15-19,37H,1-2,7-12,29H2,(H,33,46)(H,34,45)(H,35,44)(H,36,47)(H,38,39)(H,40,41)(H,42,43)(H,48,49)(H4,30,31,32)/t15-,16-,17-,18-,19-/m0/s1 InChIKey=FIJIJWHMTAZEBK-VMXHOPILSA-N |
| Database reference: |