BIOPEP-UWM: Report
| ID | 11418 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 598.6871 | Monoisotopic mass | 598.3315 | |
| IC50 : | 62.62 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kurniasari I., Swasono R. T., Raharjo T. J. | |
| Title | |
| Rational design of α-glucosidase inhibitor peptides derived from goat (Capra hircus) milk casein. Int. J. Pept. Res. Therapeut., 32, 25, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C27H46N6O9/c1-5-14(3)21(29)26(40)33-13-7-8-18(33)24(38)32-22(15(4)6-2)25(39)30-16(10-12-20(35)36)23(37)31-17(27(41)42)9-11-19(28)34/h14-18,21-22H,5-13,29H2,1-4H3,(H2,28,34)(H,30,39)(H,31,37)(H,32,38)(H,35,36)(H,41,42)/t14-,15-,16-,17-,18-,21-,22-/m0/s1 InChIKey=GBIDOFFMPAEQHX-LCDGHNAASA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8613); the DFBP database; the MBPDB database |
| Database reference: |