BIOPEP-UWM: Report
| ID | 11419 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 482.4848 | Monoisotopic mass | 482.1795 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang H., Kong F., Mo L., Wu Y., Lou A., Shen Q., Quan W., Zhou L., Li M., Liu Y. | |
| Title | |
| From waste to bioactive ingredient: integrated extraction, identification, and validation of novel antioxidant peptides from Xuefeng Black-Bone Chicken bones. Foods, 15, 942, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C24H26N4O7/c25-17(10-14-12-26-18-4-2-1-3-16(14)18)22(32)27-19(11-21(30)31)23(33)28-20(24(34)35)9-13-5-7-15(29)8-6-13/h1-8,12,17,19-20,26,29H,9-11,25H2,(H,27,32)(H,28,33)(H,30,31)(H,34,35)/t17-,19-,20-/m0/s1 InChIKey=OFCKFBGRYHOKFP-IHPCNDPISA-N |
| Database reference: |
| ChEBI: ID 164549 Metabolomics Workbench: ID 85934 PubChem: CID 145458318 UniChem: ID 176706817 Wikidata: ID Q106023877 |