BIOPEP-UWM: Report
| ID | 11424 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 9 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 927.0503 | Monoisotopic mass | 926.5056 | |
| IC50 : | 2020.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang D., Wei G., Huang A. | |
| Title | |
| Identification and molecular mechanisms of novel α-glucosidase inhibitory peptides from Xundian cured beef: In vitro, molecular docking, and molecular dynamics studies. LWT, 239, 118979, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C41H70N10O14/c1-8-22(6)33(50-37(60)28-13-11-15-51(28)40(63)23(7)43)39(62)46-25(16-20(2)3)36(59)49-32(21(4)5)38(61)47-26(17-30(53)54)34(57)44-19-29(52)45-24(12-9-10-14-42)35(58)48-27(41(64)65)18-31(55)56/h20-28,32-33H,8-19,42-43H2,1-7H3,(H,44,57)(H,45,52)(H,46,62)(H,47,61)(H,48,58)(H,49,59)(H,50,60)(H,53,54)(H,55,56)(H,64,65)/t22-,23-,24-,25-,26-,27-,28-,32-,33-/m0/s1 InChIKey=JOQFTEVNZSIEJK-HFELWZQXSA-N |
| Database reference: |
| ChEBI: ID 164549 Metabolomics Workbench: ID 85934 PubChem: CID 145458318 UniChem: ID 176706817 Wikidata: ID Q106023877 |