BIOPEP-UWM: Report
| ID | 11425 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 9 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 1066.0748 | Monoisotopic mass | 1065.4388 | |
| IC50 : | 1550.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang D., Wei G., Huang A. | |
| Title | |
| Identification and molecular mechanisms of novel α-glucosidase inhibitory peptides from Xundian cured beef: In vitro, molecular docking, and molecular dynamics studies. LWT, 239, 118979, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C48H63N11O17/c1-24(2)40(49)46(73)51-21-37(63)53-35(22-60)44(71)55-31(16-25-5-9-28(61)10-6-25)42(69)54-30(13-14-38(64)65)41(68)57-33(19-39(66)67)47(74)59-15-3-4-36(59)45(72)56-32(17-26-7-11-29(62)12-8-26)43(70)58-34(48(75)76)18-27-20-50-23-52-27/h5-12,20,23-24,30-36,40,60-62H,3-4,13-19,21-22,49H2,1-2H3,(H,50,52)(H,51,73)(H,53,63)(H,54,69)(H,55,71)(H,56,72)(H,57,68)(H,58,70)(H,64,65)(H,66,67)(H,75,76)/t30-,31-,32-,33-,34-,35-,36-,40-/m0/s1 InChIKey=BFXGSKXAEJGCEY-CLIDIZERSA-N |
| Database reference: |