BIOPEP-UWM: Report
| ID | 11426 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 608.6853 | Monoisotopic mass | 608.3272 | |
| IC50 : | 7730.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zheng X., Chi H., Ma S., Zhao L., Cai S. | |
| Title | |
| Identification of novel α-glucosidase inhibitory peptides in rice wine and their antioxidant activities using in silico and in vitro analyses, LWT-Food Sci. and Technol. 178, 114629, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C27H44N8O8/c1-15(2)11-19(33-25(41)21(14-37)35-22(38)17(28)13-36)23(39)34-20(12-16-7-4-3-5-8-16)24(40)32-18(26(42)43)9-6-10-31-27(29)30/h3-5,7-8,15,17-21,36-37H,6,9-14,28H2,1-2H3,(H,32,40)(H,33,41)(H,34,39)(H,35,38)(H,42,43)(H4,29,30,31)/t17-,18-,19-,20-,21-/m0/s1 InChIKey=NQVLOSDJLPWSRZ-SXYSDOLCSA-N |
| Database reference: |