BIOPEP-UWM: Report
| ID | 11427 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 647.7213 | Monoisotopic mass | 647.3381 | |
| IC50 : | 9180.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zheng X., Chi H., Ma S., Zhao L., Cai S. | |
| Title | |
| Identification of novel α-glucosidase inhibitory peptides in rice wine and their antioxidant activities using in silico and in vitro analyses, LWT-Food Sci. and Technol. 178, 114629, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C29H45N9O8/c1-16(39)23(27(44)38-14-6-10-21(38)26(43)35-19(28(45)46)9-5-13-34-29(32)33)37-25(42)20(15-17-7-3-2-4-8-17)36-24(41)18(30)11-12-22(31)40/h2-4,7-8,16,18-21,23,39H,5-6,9-15,30H2,1H3,(H2,31,40)(H,35,43)(H,36,41)(H,37,42)(H,45,46)(H4,32,33,34)/t16-,18+,19+,20+,21+,23+/m1/s1 InChIKey=NZARKNCPZXOAIL-KULQPPLZSA-N |
| Database reference: |