BIOPEP-UWM: Report
| ID | 11430 |
| Name | Neuroprotective peptide |
| sequence |
| Function: | |||
| Peptide preventing neurodegeneration in Caenorhabditis elegans | |||
| Number of residues | 6 |
Activity code | neup |
| Activity : | neuroprotective |
|||
| Chemical mass | 789.8651 | Monoisotopic mass | 790.3954 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen M., Zhu Z., Wu S., Huang A., Xie Z., Cai J., Huang R., Yu S., Liu M., Zhang J., Tse Y., Wu Q., Wang J., Ding Y. | |
| Title | |
| SKN-1 is indispensable for protection against Aβ-induced proteotoxicity by a selenopeptide derived from Cordyceps militaris. Redox Biol., 70, 103065, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC[Se]C)C(=O)O InChI=1S/C33H62N10O7Se/c1-19(2)18-24(29(46)41-23(32(49)50)13-17-51-5)42-28(45)21(10-6-7-14-34)39-27(44)22(11-8-15-38-33(36)37)40-30(47)25-12-9-16-43(25)31(48)26(35)20(3)4/h19-26H,6-18,34-35H2,1-5H3,(H,39,44)(H,40,47)(H,41,46)(H,42,45)(H,49,50)(H4,36,37,38)/t21-,22-,23-,24-,25-,26-/m0/s1 InChIKey=WPRXWXYUQHPURB-FRSCJGFNSA-N {SeM} - Selenomethionine; ID 128 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |