BIOPEP-UWM: Report
| ID | 11431 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 6 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 731.7829 | Monoisotopic mass | 732.3424 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu A., Ji Y., Ma G., Xu J., Hu Q. | |
| Title | |
| Identification and preparation of selenium- containing peptides from selenium-enriched Pleurotus eryngii and their protective effect on lead-induced oxidative damage in NCTC1469 hepatocytes. J. Sci. Food Agri., 103, 4522–4534, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C[SeH])C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C36H64N10O12Se/c1-5-19(4)29(46-33(54)23(11-13-27(40)48)42-34(55)25(17-59)45-30(51)20(38)9-14-28(49)50)35(56)43-22(10-12-26(39)47)32(53)41-21(8-6-7-15-37)31(52)44-24(36(57)58)16-18(2)3/h18-25,29,59H,5-17,37-38H2,1-4H3,(H2,39,47)(H2,40,48)(H,41,53)(H,42,55)(H,43,56)(H,44,52)(H,45,51)(H,46,54)(H,49,50)(H,57,58)/t19-,20-,21-,22-,23-,24-,25-,29-/m0/s1 InChIKey=JPNMPDSIVISUKI-MBRPOFBTSA-N U - Selenocysteine; ID 127 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |