BIOPEP-UWM: Report
| ID | 11433 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1098.2947 | Monoisotopic mass | 1097.6327 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jiang M., Liu Y., Xue Y., Zhang M., Liu J., Wu L., Zheng T., Wang S. | |
| Title | |
| Angiotensin-converting enzyme inhibitory peptides from the soybean meal: screening, interaction, and their protective effects on Ang II-induced EA.Hy926 injury. J. Agric. Food Chem., 74, 10207–10219, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C51H83N15O12/c1-6-29(4)41(64-42(69)30(5)53)49(76)66-24-14-20-37(66)46(73)63-40(28(2)3)47(74)61-34(26-38(54)67)44(71)60-33(17-10-11-21-52)48(75)65-23-13-19-36(65)45(72)58-27-39(68)59-32(18-12-22-57-51(55)56)43(70)62-35(50(77)78)25-31-15-8-7-9-16-31/h7-9,15-16,28-30,32-37,40-41H,6,10-14,17-27,52-53H2,1-5H3,(H2,54,67)(H,58,72)(H,59,68)(H,60,71)(H,61,74)(H,62,70)(H,63,73)(H,64,69)(H,77,78)(H4,55,56,57)/t29-,30-,32-,33-,34-,35-,36-,37-,40-,41-/m0/s1 InChIKey=FCSYYAKXCKCBFY-OFCXVDGTSA-N |
| Database reference: |