BIOPEP-UWM: Report
| ID | 11434 |
| Name | Sleep-enhancing peptide |
| sequence |
| Function: | |||
| Sleep-enhancing effect in mice | |||
| Number of residues | 6 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 810.8926 | Monoisotopic mass | 810.3689 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mo L., Wang S., Wu B., Zhao C., Yu Y., Li J., Wang H. | |
| Title | |
| Identification and exploration of sleep-enhancing peptides from goat milk casein by peptidomics and virtual screening. Food Res. Int., 221, 117333, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C42H50N8O9/c1-24(46-38(54)30(43)20-25-8-3-2-4-9-25)37(53)48-33(22-27-23-45-31-11-6-5-10-29(27)31)41(57)50-19-7-12-35(50)40(56)47-32(17-18-36(44)52)39(55)49-34(42(58)59)21-26-13-15-28(51)16-14-26/h2-6,8-11,13-16,23-24,30,32-35,45,51H,7,12,17-22,43H2,1H3,(H2,44,52)(H,46,54)(H,47,56)(H,48,53)(H,49,55)(H,58,59)/t24-,30-,32-,33-,34-,35-/m0/s1 InChIKey=CELSYCWEJCJQAU-ILGUYMTBSA-N |
| Database reference: |