BIOPEP-UWM: Report
| ID | 11437 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 907.9100 | Monoisotopic mass | 908.3855 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen X., Liu W., Zhang J., Li H., Liu X. | |
| Title | |
| Selenium-enriched peptides identified from selenium-enriched soybean protein hydrolysate: Protective effects against heat damage in Caco-2 cells. Food Funct., 14, 7882–7896, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C50H70N10O14/c1-24(2)19-37(50(73)74)57-45(68)35(21-30-23-52-34-12-9-8-11-32(30)34)56-48(71)41(28(7)61)59-43(66)27(6)54-47(70)40(25(3)4)58-42(65)26(5)53-44(67)36(22-39(63)64)55-46(69)38-13-10-18-60(38)49(72)33(51)20-29-14-16-31(62)17-15-29/h8-9,11-12,14-17,23-28,33,35-38,40-41,52,61-62H,10,13,18-22,51H2,1-7H3,(H,53,67)(H,54,70)(H,55,69)(H,56,71)(H,57,68)(H,58,65)(H,59,66)(H,63,64)(H,73,74)/t26-,27-,28+,33-,35-,36-,37-,38-,40-,41-/m0/s1 InChIKey=KMJWWDCOBKUZEJ-OCFZZSAOSA-N U - Selenocysteine; ID 127 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |