BIOPEP-UWM: Report
| ID | 11438 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 965.9493 | Monoisotopic mass | 966.4022 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen X., Liu W., Zhang J., Li H., Liu X. | |
| Title | |
| Selenium-enriched peptides identified from selenium-enriched soybean protein hydrolysate: Protective effects against heat damage in Caco-2 cells. Food Funct., 14, 7882–7896, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C[SeH])C(=O)O InChI=1S/C37H66N12O13Se/c1-19(2)15-24(46-32(57)23(10-11-28(52)53)43-29(54)20(39)16-50)33(58)44-22(8-5-13-42-37(40)41)30(55)47-25(17-51)35(60)49-14-6-9-27(49)34(59)45-21(7-3-4-12-38)31(56)48-26(18-63)36(61)62/h19-27,50-51,63H,3-18,38-39H2,1-2H3,(H,43,54)(H,44,58)(H,45,59)(H,46,57)(H,47,55)(H,48,56)(H,52,53)(H,61,62)(H4,40,41,42)/t20-,21-,22-,23-,24-,25-,26-,27-/m0/s1 InChIKey=NVPKNTCUARCLOE-APGJSSKUSA-N U - Selenocysteine; ID 127 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |