BIOPEP-UWM: Report
| ID | 11444 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 569.5932 | Monoisotopic mass | 570.2310 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen B., Miao J., Ye H., Xia Z., Huang W., Guo J., Liang X., Yin Y., Zheng Y., Cao Y. | |
| Title | |
| Purification, identification, and mechanistic investigation of novel selenium-enriched antioxidant peptides from Moringa oleifera seeds. J. Agric. Food Chem., 71, 4625–4637, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC[Se]C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C26H42N4O5Se/c1-16(2)13-21(29-23(31)19(27)15-18-9-7-6-8-10-18)25(33)28-20(11-12-36-5)24(32)30-22(26(34)35)14-17(3)4/h6-10,16-17,19-22H,11-15,27H2,1-5H3,(H,28,33)(H,29,31)(H,30,32)(H,34,35)/t19-,20-,21-,22-/m0/s1 InChIKey=LYGQLNDWYADOBF-CMOCDZPBSA-N {SeM} - Selenomethionine; ID 128 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |