BIOPEP-UWM: Report
| ID | 11448 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 493.4974 | Monoisotopic mass | 494.1998 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen B., Miao J., Ye H., Xia Z., Huang W., Guo J., Liang X., Yin Y., Zheng Y., Cao Y. | |
| Title | |
| Purification, identification, and mechanistic investigation of novel selenium-enriched antioxidant peptides from Moringa oleifera seeds. J. Agric. Food Chem., 71, 4625–4637, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC[Se]C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C20H38N4O5Se/c1-11(2)9-14(21)18(26)23-15(7-8-30-6)19(27)22-13(5)17(25)24-16(20(28)29)10-12(3)4/h11-16H,7-10,21H2,1-6H3,(H,22,27)(H,23,26)(H,24,25)(H,28,29)/t13-,14-,15-,16-/m0/s1 InChIKey=KEJOARGHHNWRCK-VGWMRTNUSA-N {SeM} - Selenomethionine; ID 128 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |