BIOPEP-UWM: Report
| ID | 11449 |
| Name | Glycation suppressing peptide |
| sequence |
| Function: | |||
| Glycation suppression | |||
| Number of residues | 5 |
Activity code | gsup |
| Activity : | glycation suppressing |
|||
| Chemical mass | 547.5992 | Monoisotopic mass | 547.2633 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang S., Hou Y., Yuan Y., Li W., Wu T., Wang Z., Zou J., Xu X. | |
| Title | |
| Natural peptides from Vigna radiata protein hydrolysates suppress protein glycation via radical scavenging and targeted interactions. Food Chem., 514, 149102, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O InChI=1S/C26H37N5O8/c1-15(2)11-18(24(37)28-14-22(34)35)29-25(38)20-9-6-10-31(20)26(39)19(13-21(32)33)30-23(36)17(27)12-16-7-4-3-5-8-16/h3-5,7-8,15,17-20H,6,9-14,27H2,1-2H3,(H,28,37)(H,29,38)(H,30,36)(H,32,33)(H,34,35)/t17-,18-,19-,20-/m0/s1 InChIKey=XGADXGUALBOOHX-MUGJNUQGSA-N |
| Database reference: |