BIOPEP-UWM: Report
| ID | 11456 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 907.1035 | Monoisotopic mass | 906.5198 | |
| IC50 : | 465.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kalyan S., Raman R. K., Misra D., Sansi M. S., Meena S. | |
| Title | |
| Bikaneri camel milk-derived low-molecular-weight peptides as a novel therapeutic approach for diabetes. Int. J. Pept. Res. Therapeut., 32, 40, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C47H70N8O10/c1-27(2)21-34(42(59)51-35(22-28(3)4)43(60)54-38(26-56)44(61)53-37(47(64)65)23-29(5)6)50-40(57)30(7)49-45(62)39-19-14-20-55(39)46(63)36(25-32-17-12-9-13-18-32)52-41(58)33(48)24-31-15-10-8-11-16-31/h8-13,15-18,27-30,33-39,56H,14,19-26,48H2,1-7H3,(H,49,62)(H,50,57)(H,51,59)(H,52,58)(H,53,61)(H,54,60)(H,64,65)/t30-,33-,34-,35-,36-,37-,38-,39-/m0/s1 InChIKey=VRSIHYZIOVMLEG-ALJZBVAKSA-N |
| Database reference: |