BIOPEP-UWM: Report
| ID | 11458 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 671.7823 | Monoisotopic mass | 671.3631 | |
| IC50 : | 557.70 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kalyan S., Raman R. K., Misra D., Sansi M. S., Meena S. | |
| Title | |
| Bikaneri camel milk-derived low-molecular-weight peptides as a novel therapeutic approach for diabetes. Int. J. Pept. Res. Therapeut., 32, 40, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C33H49N7O8/c1-19(2)17-24(38-29(43)23(13-14-27(34)41)37-28(42)22-11-7-15-35-22)30(44)36-20(3)32(46)40-16-8-12-26(40)31(45)39-25(33(47)48)18-21-9-5-4-6-10-21/h4-6,9-10,19-20,22-26,35H,7-8,11-18H2,1-3H3,(H2,34,41)(H,36,44)(H,37,42)(H,38,43)(H,39,45)(H,47,48)/t20-,22-,23-,24-,25-,26-/m0/s1 InChIKey=VFSWFZJXHDGTNF-YNAZAZDCSA-N |
| Database reference: |