BIOPEP-UWM: Report
| ID | 11462 |
| Name | GLP-1 secretion stimulator |
| sequence |
| Function: | |||
| Stimulation of GLP-1 secretion in cell culture | |||
| Number of residues | 12 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 1308.6275 | Monoisotopic mass | 1307.7288 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kalyan S., Raman R. K., Misra D., Sansi M. S., Meena S. | |
| Title | |
| Bikaneri camel milk-derived low-molecular-weight peptides as a novel therapeutic approach for diabetes. Int. J. Pept. Res. Therapeut., 32, 40, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C64H101N13O14S/c1-35(2)32-41(65)60(86)77-30-17-23-49(77)62(88)75-28-15-21-47(75)57(83)70-44(33-36(3)4)55(81)69-43(24-25-50(66)78)61(87)74-27-14-20-46(74)56(82)67-39(9)53(79)72-51(37(5)6)59(85)68-42(26-31-92-10)54(80)73-52(38(7)8)63(89)76-29-16-22-48(76)58(84)71-45(64(90)91)34-40-18-12-11-13-19-40/h11-13,18-19,35-39,41-49,51-52H,14-17,20-34,65H2,1-10H3,(H2,66,78)(H,67,82)(H,68,85)(H,69,81)(H,70,83)(H,71,84)(H,72,79)(H,73,80)(H,90,91)/t39-,41-,42-,43-,44-,45-,46-,47-,48-,49-,51-,52-/m0/s1 InChIKey=MJCQECBRWPWQQD-GEZHDFSMSA-N |
| Database reference: |