BIOPEP-UWM: Report
| ID | 11465 |
| Name | GLP-1 secretion stimulator |
| sequence |
| Function: | |||
| Stimulation of GLP-1 secretion in cell culture | |||
| Number of residues | 8 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 907.1035 | Monoisotopic mass | 906.5198 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kalyan S., Raman R. K., Misra D., Sansi M. S., Meena S. | |
| Title | |
| Bikaneri camel milk-derived low-molecular-weight peptides as a novel therapeutic approach for diabetes. Int. J. Pept. Res. Therapeut., 32, 40, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C48H74N12O13S/c1-8-25(4)40(47(71)60-16-11-14-35(60)45(69)57-31(15-17-74-7)42(66)53-23-38(64)56-34(48(72)73)18-24(2)3)59-44(68)33(20-36(49)62)58-43(67)32(19-28-21-51-30-13-10-9-12-29(28)30)55-37(63)22-52-41(65)26(5)54-46(70)39(50)27(6)61/ InChIKey=CYXSRFJBQXVNTM-VHKHVIIBSA-N |
| Database reference: |