BIOPEP-UWM: Report
| ID | 11469 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 6 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 747.9008 | Monoisotopic mass | 747.3613 | |
| IC50 : | 3440.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhi W., Lu S., Bao S., Han R., Wang C., He J., Zhang Y. | |
| Title | |
| Discovery and characterization of xanthine oxidase inhibitory peptides from milk protein hydrolysates: in vitro screening, molecular docking and QSAR modeling. Int. Dairy J., 179, 106680, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C35H53N7O9S/c1-18(2)15-25(30(45)40-26(35(50)51)16-21-17-37-23-10-7-6-9-22(21)23)39-31(46)27-11-8-13-42(27)34(49)24(12-14-52-5)38-33(48)29(20(4)44)41-32(47)28(36)19(3)43/h6-7,9-10,17-20,24-29,37,43-44H,8,11-16,36H2,1-5H3,(H,38,48)(H,39,46)(H,40,45)(H,41,47)(H,50,51)/t19-,20-,24+,25+,26+,27+,28+,29+/m1/s1 InChIKey=QGGBSIAUWWUJLC-QAPARMCSSA-N |
| Database reference: |