BIOPEP-UWM: Report
| ID | 11470 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 6 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 673.8410 | Monoisotopic mass | 673.4150 | |
| IC50 : | 9350.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhi W., Lu S., Bao S., Han R., Wang C., He J., Zhang Y. | |
| Title | |
| Discovery and characterization of xanthine oxidase inhibitory peptides from milk protein hydrolysates: in vitro screening, molecular docking and QSAR modeling. Int. Dairy J., 179, 106680, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C34H55N7O7/c1-6-21(4)28(40-30(43)24(36)15-10-11-17-35)33(46)41-18-12-16-26(41)31(44)37-22(5)29(42)39-27(20(2)3)32(45)38-25(34(47)48)19-23-13-8-7-9-14-23/h7-9,13-14,20-22,24-28H,6,10-12,15-19,35-36H2,1-5H3,(H,37,44)(H,38,45)(H,39,42)(H,40,43)(H,47,48)/t21-,22-,24-,25-,26-,27-,28-/m0/s1 InChIKey=WUYSKKZQUIZLLX-OVELHQAISA-N |
| Database reference: |