BIOPEP-UWM: Report
| ID | 11473 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 508.4262 | Monoisotopic mass | 509.1381 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang X., He H., Xiang J., Hou T. | |
| Title | |
| Screening and bioavailability evaluation of anti-oxidative selenium-containing peptides from soybeans based on specific structures. Food Funct., 13, 5252–5261, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC[Se]C)C(=O)O InChI=1S/C18H31N5O7Se/c1-31-8-6-12(18(29)30)22-15(26)11(4-5-14(20)25)21-16(27)13-3-2-7-23(13)17(28)10(19)9-24/h10-13,24H,2-9,19H2,1H3,(H2,20,25)(H,21,27)(H,22,26)(H,29,30)/t10-,11-,12-,13-/m0/s1 InChIKey=CUAGDBNPYKGUBA-CYDGBPFRSA-N {SeM} - Selenomethionine; ID 128 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |