BIOPEP-UWM: Report
| ID | 11474 |
| Name | Neuroprotective peptide |
| sequence |
| Function: | |||
| Peptide Inhibiting Aβ aggregation in cell culture | |||
| Number of residues | 6 |
Activity code | neup |
| Activity : | neuroprotective |
|||
| Chemical mass | 822.7662 | Monoisotopic mass | 823.3079 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi W., Zhang Y., Cong X., Huang D., Yu R., Chen S., Zhu S. | |
| Title | |
| Protective effect of selenium-enriched protein from Cardamine violifolia digestion products on PC12 cells injury induced by Aβ1-42. Food Biosci, 68, 106492, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC[Se]C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C30H53N11O11Se/c1-14(2)23(33)28(50)39-16(6-8-20(31)42)25(47)37-15(5-4-11-36-30(34)35)24(46)38-17(10-12-53-3)26(48)41-19(13-22(44)45)27(49)40-18(29(51)52)7-9-21(32)43/h14-19,23H,4-13,33H2,1-3H3,(H2,31,42)(H2,32,43)(H,37,47)(H,38,46)(H,39,50)(H,40,49)(H,41,48)(H,44,45)(H,51,52)(H4,34,35,36)/t15-,16-,17-,18-,19-,23-/m0/s1 InChIKey=WNTLXEFOYUFOCP-JOICOZTFSA-N {SeM} - Selenomethionine; ID 128 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |