BIOPEP-UWM: Report
| ID | 11477 |
| Name | Neuroprotective peptide |
| sequence |
| Function: | |||
| Peptide Inhibiting Aβ aggregation in cell culture | |||
| Number of residues | 6 |
Activity code | neup |
| Activity : | neuroprotective |
|||
| Chemical mass | 765.7975 | Monoisotopic mass | 766.3478 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi W., Zhang Y., Cong X., Huang D., Yu R., Chen S., Zhu S. | |
| Title | |
| Protective effect of selenium-enriched protein from Cardamine violifolia digestion products on PC12 cells injury induced by Aβ1-42. Food Biosci, 68, 106492, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C[SeH])C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C31H58N8O9Se/c1-17(2)15-22(28(44)35-19(9-5-7-13-32)26(42)37-21(31(47)48)10-6-8-14-33)38-29(45)23(16-49)39-27(43)20(11-12-24(40)41)36-30(46)25(34)18(3)4/h17-23,25,49H,5-16,32-34H2,1-4H3,(H,35,44)(H,36,46)(H,37,42)(H,38,45)(H,39,43)(H,40,41)(H,47,48)/t19-,20-,21-,22-,23-,25-/m0/s1 InChIKey=PNMPEJIQOOMMAY-RYBBFAMKSA-N U - Selenocysteine; ID 127 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |