BIOPEP-UWM: Report
| ID | 11478 |
| Name | Neuroprotective peptide |
| sequence |
| Function: | |||
| Peptide Inhibiting Aβ aggregation in cell culture | |||
| Number of residues | 5 |
Activity code | neup |
| Activity : | neuroprotective |
|||
| Chemical mass | 598.5501 | Monoisotopic mass | 599.2172 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi W., Zhang Y., Cong X., Huang D., Yu R., Chen S., Zhu S. | |
| Title | |
| Protective effect of selenium-enriched protein from Cardamine violifolia digestion products on PC12 cells injury induced by Aβ1-42. Food Biosci, 68, 106492, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C[SeH])C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C21H41N7O8Se/c22-7-3-1-5-12(24)17(31)26-14(9-29)19(33)28-16(11-37)20(34)27-15(10-30)18(32)25-13(21(35)36)6-2-4-8-23/h12-16,29-30,37H,1-11,22-24H2,(H,25,32)(H,26,31)(H,27,34)(H,28,33)(H,35,36)/t12-,13-,14-,15-,16-/m0/s1 InChIKey=KPLAJQWVINIMLL-QXKUPLGCSA-N U - Selenocysteine; ID 127 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |