BIOPEP-UWM: Report
| ID | 11479 |
| Name | Neuroprotective peptide |
| sequence |
| Function: | |||
| Peptide Inhibiting Aβ aggregation in cell culture | |||
| Number of residues | 5 |
Activity code | neup |
| Activity : | neuroprotective |
|||
| Chemical mass | 680.6537 | Monoisotopic mass | 681.2702 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi W., Zhang Y., Cong X., Huang D., Yu R., Chen S., Zhu S. | |
| Title | |
| Protective effect of selenium-enriched protein from Cardamine violifolia digestion products on PC12 cells injury induced by Aβ1-42. Food Biosci, 68, 106492, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C[SeH])C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C25H47N9O8Se/c1-13(2)19(27)23(40)32-15(8-9-18(35)36)21(38)31-14(7-5-11-30-25(28)29)20(37)34-17(12-43)22(39)33-16(24(41)42)6-3-4-10-26/h13-17,19,43H,3-12,26-27H2,1-2H3,(H,31,38)(H,32,40)(H,33,39)(H,34,37)(H,35,36)(H,41,42)(H4,28,29,30)/t14-,15-,16-,17-,19-/m0/s1 InChIKey=AHZXDITXCQEPEM-WSRJKRBPSA-N U - Selenocysteine; ID 127 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |