BIOPEP-UWM: Report
| ID | 11480 |
| Name | Neuroprotective peptide |
| sequence |
| Function: | |||
| Peptide Inhibiting Aβ aggregation in cell culture | |||
| Number of residues | 5 |
Activity code | neup |
| Activity : | neuroprotective |
|||
| Chemical mass | 496.4399 | Monoisotopic mass | 497.0841 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi W., Zhang Y., Cong X., Huang D., Yu R., Chen S., Zhu S. | |
| Title | |
| Protective effect of selenium-enriched protein from Cardamine violifolia digestion products on PC12 cells injury induced by Aβ1-42. Food Biosci, 68, 106492, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(C[SeH])C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C16H27N5O6SSe/c1-8(15(25)21-4-2-3-11(21)16(26)27)19-12(22)5-18-14(24)10(7-29)20-13(23)9(17)6-28/h8-11,28-29H,2-7,17H2,1H3,(H,18,24)(H,19,22)(H,20,23)(H,26,27)/t8-,9-,10-,11-/m0/s1 InChIKey=LAAUTGOLHKPQOY-NAKRPEOUSA-N U - Selenocysteine; ID 127 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |