BIOPEP-UWM: Report
| ID | 11482 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 11 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1208.3622 | Monoisotopic mass | 1207.6330 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jin Y., Zhang J., Miao J., Peng Z., Liu Y., Zhao Z. | |
| Title | |
| Novel antioxidant peptides from chicken bone hydrolysate: Identification, structure–activity relationship and cytoprotective effects against oxidative stress in HaCaT cells. Food Chem. X, 36, 103962, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C56H85N15O15/c1-5-32(4)46(54(84)65-36(18-12-22-61-56(59)60)49(79)67-39(25-33-14-8-6-9-15-33)52(82)68-40(55(85)86)26-34-16-10-7-11-17-34)70-53(83)42-19-13-23-71(42)45(76)28-63-48(78)41(30-73)69-51(81)38(24-31(2)3)66-50(80)37(20-21-43(58)74)64-44(75)27-62-47(77)35(57)29-72/h6-11,14-17,31-32,35-42,46,72-73H,5,12-13,18-30,57H2,1-4H3,(H2,58,74)(H,62,77)(H,63,78)(H,64,75)(H,65,84)(H,66,80)(H,67,79)(H,68,82)(H,69,81)(H,70,83)(H,85,86)(H4,59,60,61)/t32-,35-,36-,37-,38-,39-,40-,41-,42-,46-/m0/s1 InChIKey=IJBAFVLKEWSBMI-AFBNONGGSA-N |
| Database reference: |