BIOPEP-UWM: Report
| ID | 11484 |
| Name | Immunomodulating peptide |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 7 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 810.9800 | Monoisotopic mass | 810.4738 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gonzalez-de la Rosa T., Rivero-Pino F., Barrera-Chamorro L., Marquez-Paradas E., Fernández-Prior Á., Claro-Cala C. M., Montserrat-de la Paz S. | |
| Title | |
| Evaluation of pharmacokinetic, immunomodulatory and antihypertensive properties of olive mill by-product–derived peptides using cell models and molecular docking analysis. J. Food Biochem., 1638665, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C40H62N10O8/c1-23(2)31(35(53)45-27(39(57)58)22-25-12-6-5-7-13-25)46-33(51)29-16-10-20-49(29)37(55)30-17-11-21-50(30)38(56)32(24(3)4)47-34(52)28-15-9-19-48(28)36(54)26(41)14-8-18-44-40(42)43/h5-7,12-13,23-24,26-32H,8-11,14-22,41H2,1-4H3,(H,45,53)(H,46,51)(H,47,52)(H,57,58)(H4,42,43,44)/t26-,27-,28-,29-,30-,31-,32-/m0/s1 InChIKey=OLBUXOGPEIXSAU-YYGRSCHNSA-N |
| Database reference: |