BIOPEP-UWM: Report
| ID | 11495 |
| Name | Immunomodulating peptide |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 6 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 631.6740 | Monoisotopic mass | 631.3166 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gonzalez-de la Rosa T., Rivero-Pino F., Barrera-Chamorro L., Marquez-Paradas E., Fernández-Prior Á., Claro-Cala C. M., Montserrat-de la Paz S. | |
| Title | |
| Evaluation of pharmacokinetic, immunomodulatory and antihypertensive properties of olive mill by-product–derived peptides using cell models and molecular docking analysis. J. Food Biochem., 1638665, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C26H45N7O11/c1-11(2)8-14(27)21(38)32-20(13(4)36)25(42)33-7-5-6-17(33)23(40)31-19(12(3)35)24(41)30-16(10-34)22(39)29-15(26(43)44)9-18(28)37/h11-17,19-20,34-36H,5-10,27H2,1-4H3,(H2,28,37)(H,29,39)(H,30,41)(H,31,40)(H,32,38)(H,43,44)/t12-,13-,14+,15+,16+,17+,19+,20+/m1/s1 InChIKey=SSEHATUJXYKJAB-JLOIIDPSSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 8360) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8360 |