BIOPEP-UWM: Report
| ID | 11501 |
| Name | Arginase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of arginase (EC 3.5.3.1) | |||
| Number of residues | 5 |
Activity code | argi |
| Activity : | arginase inhibitor |
|||
| Chemical mass | 611.6067 | Monoisotopic mass | 611.2768 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chukwuejim S., Fatoki T. H., Aluko R. E. | |
| Title | |
| In silico rational investigation of C-terminal arginine-containing white Lupin (Lupinus albus) protein-derived peptides as arginase inhibitors. Food Chem. Mol. Sci., 12, 100419, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C23H37N11O9/c24-12(2-1-5-29-23(26)27)19(39)33-13(3-4-18(37)38)20(40)30-9-17(36)32-14(7-16(25)35)21(41)34-15(22(42)43)6-11-8-28-10-31-11/h8,10,12-15H,1-7,9,24H2,(H2,25,35)(H,28,31)(H,30,40)(H,32,36)(H,33,39)(H,34,41)(H,37,38)(H,42,43)(H4,26,27,29)/t12-,13-,14-,15-/m0/s1 InChIKey=GPMREAJCRQOZCE-AJNGGQMLSA-N |
| Database reference: |