BIOPEP-UWM: Report
| ID | 11502 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 4 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 512.5965 | Monoisotopic mass | 512.2626 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cao R., Li W., Zhang J., Bao X., Feng H., Sun J., Liu X., Sun L. | |
| Title | |
| Milk casein hydrolysate peptides regulate starch digestion through inhibition of α-glucosidase: An insight into the active oligopeptide screening, enzyme inhibition behaviors, and oligopeptide-enzyme binding interactions. Food Hydrocolloids, 152, 109926, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C27H36N4O6/c1-17(2)13-23(27(36)37)31-26(35)22(15-19-11-7-4-8-12-19)30-25(34)21(29-24(33)20(28)16-32)14-18-9-5-3-6-10-18/h3-12,17,20-23,32H,13-16,28H2,1-2H3,(H,29,33)(H,30,34)(H,31,35)(H,36,37)/t20-,21-,22-,23-/m0/s1 InChIKey=FCDCHGHFUKAZJO-MLCQCVOFSA-N |
| Database reference: |
| PubChem: CID 71354341 |