BIOPEP-UWM: Report
| ID | 11503 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 4 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 522.5914 | Monoisotopic mass | 522.2470 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cao R., Li W., Zhang J., Bao X., Feng H., Sun J., Liu X., Sun L. | |
| Title | |
| Milk casein hydrolysate peptides regulate starch digestion through inhibition of α-glucosidase: An insight into the active oligopeptide screening, enzyme inhibition behaviors, and oligopeptide-enzyme binding interactions. Food Hydrocolloids, 152, 109926, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C28H34N4O6/c29-21(16-19-10-12-20(33)13-11-19)26(35)31-14-4-8-23(31)25(34)30-22(17-18-6-2-1-3-7-18)27(36)32-15-5-9-24(32)28(37)38/h1-3,6-7,10-13,21-24,33H,4-5,8-9,14-17,29H2,(H,30,34)(H,37,38)/t21-,22-,23-,24-/m0/s1 InChIKey=DCGNJQAPLOBXDM-ZJZGAYNASA-N Opioid peptide according to the BIOPEP-UWM database of bioactive peptides (ID 2868), the DFBP database, the MBPDB database; the PubChem database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 2868 BRENDA: Ligand Tyr-Pro-Phe-Pro CAS: Registry No 74171-19-0 ChemIDplus: ID 074171190 ChemSpider: ID 151269 DFBP: ID DFBPOPIO0044 EPA CompTox: ID DTXSID70225142 EPA DSSTox: ID DTXCID70147633 EROP-Moscow: ID E00536 J-GLOBAL: ID 200907045577749233 MBPDB: Peptide YPFP MeSH: Terms beta-casomorphin 4; Tyr-pro-Phe-Pro; tyrosyl-prolyl-phenylalanyl-proline Nikkaji: ID J39.394K PubChem: CID 173253 SureChEMBL: ID 29368129 UniChem: ID 32044412 Wikidata: ID Q83104066 ZINC: ID ZINC85591238 |